CymitQuimica logo

CAS 876316-27-7

:

4-(3-Methyl-1,2,4-oxadiazol-5-yl)benzaldehyde

Description:
4-(3-Methyl-1,2,4-oxadiazol-5-yl)benzaldehyde is an organic compound characterized by its unique structure, which includes a benzaldehyde moiety and a 1,2,4-oxadiazole ring. The presence of the oxadiazole ring contributes to its potential as a bioactive compound, often exhibiting interesting pharmacological properties. This compound typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic and heterocyclic nature. Its molecular structure allows for various functional group interactions, making it a candidate for applications in medicinal chemistry, particularly in the development of new drugs or agrochemicals. The methyl group on the oxadiazole ring can influence its electronic properties and reactivity, potentially enhancing its biological activity. Additionally, the compound's aldehyde functional group can participate in various chemical reactions, such as condensation and oxidation, further expanding its utility in synthetic organic chemistry. Overall, 4-(3-Methyl-1,2,4-oxadiazol-5-yl)benzaldehyde is a versatile compound with significant implications in research and development.
Formula:C10H8N2O2
InChI:InChI=1S/C10H8N2O2/c1-7-11-10(14-12-7)9-4-2-8(6-13)3-5-9/h2-6H,1H3
InChI key:InChIKey=AEMXYVCSLPLJOW-UHFFFAOYSA-N
SMILES:CC=1N=C(ON1)C2=CC=C(C=O)C=C2
Synonyms:
  • Benzaldehyde, 4-(3-methyl-1,2,4-oxadiazol-5-yl)-
  • 4-(3-Methyl-1,2,4-oxadiazol-5-yl)benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.