CAS 876316-33-5
:4-[[2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine
Description:
4-[[2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine is an organic compound characterized by its complex structure, which includes a morpholine ring and a boron-containing moiety. The presence of the dioxaborolane group suggests that it may exhibit unique reactivity, particularly in cross-coupling reactions, making it potentially useful in organic synthesis and medicinal chemistry. The morpholine component contributes to its solubility and may influence its biological activity. This compound is likely to be a solid at room temperature, with moderate stability under standard conditions, although it may be sensitive to moisture due to the boron atom. Its molecular structure indicates potential applications in drug development or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling, as compounds containing boron and nitrogen can have specific health and environmental considerations. Overall, this compound exemplifies the intersection of organic chemistry and materials science, with implications for various applications in research and industry.
Formula:C17H26BNO3
InChI:InChI=1S/C17H26BNO3/c1-16(2)17(3,4)22-18(21-16)15-8-6-5-7-14(15)13-19-9-11-20-12-10-19/h5-8H,9-13H2,1-4H3
InChI key:InChIKey=WCNXVDLZTGODQW-UHFFFAOYSA-N
SMILES:C(C1=C(B2OC(C)(C)C(C)(C)O2)C=CC=C1)N3CCOCC3
Synonyms:- 2-(Morpholin-4-Ylmethyl)Benzeneboronic Acid, Pinacol Ester
- 4-[[2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine
- Morpholine, 4-[[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-
- 4-(2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)morpholine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)morpholine
CAS:Formula:C17H26BNO3Purity:97%Color and Shape:LiquidMolecular weight:303.20422-(Morpholin-4-ylmethyl)benzeneboronic acid, pinacol ester
CAS:2-(Morpholin-4-ylmethyl)benzeneboronic acid, pinacol esterFormula:C17H26BNO3Purity:98%Color and Shape: colourless liquidMolecular weight:303.20g/mol2-(MorpholinoMethyl)phenylboronic acid pinacol ester
CAS:2-(MorpholinoMethyl)phenylboronic acid pinacol ester is a fine chemical that can be used as a building block for the synthesis of complex compounds. It is also suitable for use in research and development, as it has been shown to be a reagent and speciality chemical. This compound is an intermediate for the synthesis of other compounds, such as pharmaceuticals, agrochemicals, and cosmetics. 2-(MorpholinoMethyl)phenylboronic acid pinacol ester can be used as a versatile building block in organic synthesis reactions. It has been shown to have high quality properties and can be used to synthesize valuable scaffolds.
Formula:C17H26BNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:303.20 g/mol4-(2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzyl)morpholine
CAS:Formula:C17H26BNO3Purity:97%Color and Shape:LiquidMolecular weight:303.21



