CAS 876317-19-0

1-(tert-butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid

Description:

1-(tert-Butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring with a carbonyl group and a carboxylic acid functional group. The tert-butoxycarbonyl (Boc) group serves as a protective group for amines, making this compound useful in peptide synthesis and other organic reactions. The presence of the oxo group contributes to its reactivity, allowing for potential applications in various synthetic pathways. This compound is typically a solid at room temperature and is soluble in organic solvents, which facilitates its use in laboratory settings. Its molecular structure suggests it may exhibit specific stereochemical properties, influencing its interactions in biological systems. As with many organic compounds, handling should be done with care, considering potential hazards associated with its reactivity and toxicity. Overall, this compound is significant in the field of organic chemistry, particularly in the synthesis of complex molecules.

Formula: C₁₀H₁₅NO₅

InChI: InChI=1/C10H15NO5/c1-10(2,3)16-9(15)11-5-6(12)4-7(11)8(13)14/h7H,4-5H2,1-3H3,(H,13,14)

SMILES: CC(C)(C)OC(=O)N1CC(=O)CC1C(=O)O

Synonyms:

• 1-(tert-Butoxycarbonyl)-4-oxoproline
• 1,2-Pyrrolidinedicarboxylic Acid, 4-Oxo-, 1-(1,1-Dimethylethyl) Ester

N-Boc-4-oxo-DL-Proline

CAS: 876317-19-0

Formula: C₁₀H₁₅NO₅

Purity: 97%

Color and Shape: Solid

Molecular weight: 229.2298

Ref: IN-DA0036DA

1-tert-(Butoxycarbonyl)pyrrolidin-4-one-2-carboxylic acid

CAS: 876317-19-0

1-tert-(Butoxycarbonyl)pyrrolidin-4-one-2-carboxylic acid

Formula: C₁₀H₁₅NO₅

Purity: 97%

Color and Shape: brown solid

Molecular weight: 229.23g/mol

Ref: 54-OR300927

1-(tert-Butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid

CAS: 876317-19-0

Formula: C₁₀H₁₅NO₅

Purity: 97%

Color and Shape: Solid, Grey powder

Molecular weight: 229.232

Ref: 10-F092922