CAS 876343-10-1

4-chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine

Description:

4-Chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused pyrrole and pyrimidine rings, which contribute to its unique chemical properties. The presence of chlorine and iodine substituents enhances its reactivity and potential biological activity. This compound typically exhibits moderate solubility in organic solvents, and its structure may influence its interactions with biological targets, making it of interest in medicinal chemistry and drug development. The halogen substituents can also affect the compound's electronic properties, potentially enhancing its ability to participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound's molecular structure may confer specific pharmacological properties, making it a candidate for further investigation in therapeutic applications. As with many heterocycles, the stability and reactivity of 4-chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.

Formula: C₆H₃ClIN₃

InChI: InChI=1/C6H3ClIN3/c7-5-3-1-4(8)11-6(3)10-2-9-5/h1-2H,(H,9,10,11)

SMILES: c1c2c(Cl)ncnc2[nH]c1I

Synonyms:

• 7H-pyrrolo[2,3-d]pyrimidine, 4-chloro-6-iodo-
• Product English Name: 4-Chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine
• 4-Chloro-6-iodo-7H-pyrrol...
• 4-chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine ISO 9001：2015 REACH
• 4-chloro-6-iodo-1H-pyrrolo[2,3-d]pyrimidine
• 4-chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine
• 4-chloro-6-iodo-7H-pyrrolo[2

4-Chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine

CAS: 876343-10-1

Formula: C₆H₃ClIN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 279.4656

Ref: IN-DA008ECT

4-Chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine

CAS: 876343-10-1

4-Chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine

Purity: 97%

Molecular weight: 279.47g/mol

Ref: 54-OR317017

4-Chloro-6-iodo-7H-pyrrolo[2,3-d]pyrimidine

CAS: 876343-10-1

Formula: C₆H₃ClIN₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 279.47

Ref: 10-F093652