CAS 876367-84-9
:cis-3,5-Piperidinedicarboxylic acid
Description:
Cis-3,5-Piperidinedicarboxylic acid is a bicyclic organic compound characterized by its piperidine ring structure, which contains two carboxylic acid functional groups at the 3 and 5 positions. This compound is notable for its potential applications in medicinal chemistry and as a building block in organic synthesis. The cis configuration indicates that the carboxylic acid groups are on the same side of the piperidine ring, which can influence its reactivity and interactions with biological targets. The presence of two carboxylic acid groups contributes to its acidity and solubility in polar solvents. Additionally, the compound may exhibit interesting biological activities, making it a subject of research in drug development. Its molecular structure allows for various modifications, which can lead to derivatives with enhanced properties. Overall, cis-3,5-Piperidinedicarboxylic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C7H11NO4
InChI:InChI=1/C7H11NO4/c9-6(10)4-1-5(7(11)12)3-8-2-4/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5+
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
