CymitQuimica logo

CAS 876379-80-5

:

3-chloropyrazolo[1,5-a]pyridine-5-carboxylic acid

Description:
3-Chloropyrazolo[1,5-a]pyridine-5-carboxylic acid is a heterocyclic compound characterized by its pyrazolo and pyridine ring systems, which contribute to its unique chemical properties. The presence of a chlorine atom at the 3-position of the pyrazolo ring enhances its reactivity and influences its biological activity. The carboxylic acid functional group at the 5-position is polar and can participate in hydrogen bonding, making the compound soluble in polar solvents. This compound is of interest in medicinal chemistry due to its potential pharmacological applications, particularly in the development of novel therapeutic agents. Its structure allows for various modifications, which can lead to derivatives with enhanced efficacy or selectivity. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the chlorine substituent and the carboxylic acid group. Overall, 3-chloropyrazolo[1,5-a]pyridine-5-carboxylic acid is a versatile compound with significant implications in chemical research and drug development.
Formula:C8H5ClN2O2
InChI:InChI=1/C8H5ClN2O2/c9-6-4-10-11-2-1-5(8(12)13)3-7(6)11/h1-4H,(H,12,13)
SMILES:c1cn2c(cc1C(=O)O)c(cn2)Cl
Synonyms:
  • Pyrazolo[1,5-A]Pyridine-5-Carboxylic Acid, 3-Chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.