CAS 87642-29-3
:3-phenyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine
Description:
3-Phenyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a bicyclic structure, with a phenyl group attached to the pyrazole moiety, enhancing its aromatic character. The presence of multiple rings often leads to interesting reactivity and potential biological activity, making it a subject of interest in medicinal chemistry. Its molecular structure suggests that it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, due to the electron-rich nature of the pyrazole ring. Additionally, the compound may exhibit solubility in organic solvents, and its stability can be influenced by substituents on the phenyl group. As with many heterocycles, it may also show potential as a ligand in coordination chemistry or as a scaffold for drug development, particularly in the search for new therapeutic agents. Further studies would be necessary to elucidate its specific properties and applications.
Formula:C12H13N3
InChI:InChI=1/C12H13N3/c1-2-4-9(5-3-1)12-10-8-13-7-6-11(10)14-15-12/h1-5,13H,6-8H2,(H,14,15)
SMILES:c1ccc(cc1)c1c2CNCCc2[nH]n1
Synonyms:- 1H-pyrazolo[4,3-c]pyridine, 4,5,6,7-tetrahydro-3-phenyl-
- 3-Phenyl-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
