CAS 87642-31-7
:3-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine
Description:
3-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyrazole and a pyridine moiety. The presence of a fluorine atom on the phenyl ring enhances its lipophilicity and may influence its biological activity. This compound typically exhibits a molecular formula that reflects its complex structure, and it is often studied for its potential pharmacological properties, including its role as a ligand in various biological systems. The tetrahydro configuration indicates that the compound is saturated in certain positions, which can affect its reactivity and interaction with biological targets. Additionally, the compound may exhibit specific solubility characteristics, stability under various conditions, and potential for forming derivatives, making it of interest in medicinal chemistry and drug development. Its CAS number, 87642-31-7, allows for easy identification and retrieval of data related to its properties and applications in scientific literature.
Formula:C12H12FN3
InChI:InChI=1S/C12H12FN3/c13-9-3-1-8(2-4-9)12-10-7-14-6-5-11(10)15-16-12/h1-4,14H,5-7H2,(H,15,16)
InChI key:InChIKey=VCEDOGBTSALKRD-UHFFFAOYSA-N
SMILES:FC1=CC=C(C=2C3=C(NN2)CCNC3)C=C1
Synonyms:- 1H-Pyrazolo[4,3-c]pyridine, 3-(4-fluorophenyl)-4,5,6,7-tetrahydro-
- 3-(4-Fluorophenyl)-4,5,6,7-tetrahydro-1H-pyrazolo[4,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.