CymitQuimica logo

CAS 876483-85-1

:

4,6-dihydroxynaphthalene-2-carboxylic acid

Description:
4,6-Dihydroxynaphthalene-2-carboxylic acid, also known by its CAS number 876483-85-1, is an organic compound characterized by its naphthalene backbone, which features two hydroxyl (-OH) groups and a carboxylic acid (-COOH) functional group. This compound exhibits properties typical of polyhydroxy aromatic acids, including potential solubility in polar solvents due to the presence of hydroxyl and carboxylic acid groups. The hydroxyl groups can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. As a naphthalene derivative, it may exhibit aromatic properties, contributing to its stability and potential applications in organic synthesis or as a precursor in the production of dyes, pharmaceuticals, or agrochemicals. The presence of multiple functional groups also suggests that it could serve as a versatile building block in chemical reactions, including esterification or coupling reactions. Overall, 4,6-dihydroxynaphthalene-2-carboxylic acid is a compound of interest in various fields of chemistry due to its structural features and potential applications.
Formula:C11H8O4
InChI:InChI=1/C11H8O4/c12-8-2-1-6-3-7(11(14)15)4-10(13)9(6)5-8/h1-5,12-13H,(H,14,15)
Synonyms:
  • 4,6-dihydroxy-2-naphthoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.