CAS 876708-03-1
:4-Amino-1-(4-C-azido-β-D-arabinofuranosyl)-2(1H)-pyrimidinone
Description:
4-Amino-1-(4-C-azido-β-D-arabinofuranosyl)-2(1H)-pyrimidinone is a chemical compound characterized by its unique structural features, which include a pyrimidinone core and an azido group attached to a β-D-arabinofuranosyl moiety. This compound is notable for its potential applications in medicinal chemistry, particularly in the development of antiviral and anticancer agents due to its nucleoside-like structure. The presence of the amino group enhances its reactivity and may contribute to its biological activity. The azido group is of particular interest in click chemistry, allowing for further functionalization and modification. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. As a synthetic derivative, it may be produced through specific chemical reactions involving nucleophilic substitutions and coupling reactions. Overall, 4-Amino-1-(4-C-azido-β-D-arabinofuranosyl)-2(1H)-pyrimidinone represents a significant interest in research focused on nucleoside analogs and their therapeutic potential.
Formula:C9H12N6O5
InChI:InChI=1S/C9H12N6O5/c10-4-1-2-15(8(19)12-4)7-5(17)6(18)9(3-16,20-7)13-14-11/h1-2,5-7,16-18H,3H2,(H2,10,12,19)/t5-,6-,7+,9+/m0/s1
InChI key:InChIKey=ODLGMSQBFONGNG-XZMZPDFPSA-N
SMILES:N(=[N+]=[N-])[C@]1(CO)O[C@H]([C@@H](O)[C@@H]1O)N2C(=O)N=C(N)C=C2
Synonyms:- 2(1H)-Pyrimidinone, 4-amino-1-(4-C-azido-β-D-arabinofuranosyl)-
- RO 9187
- 4-Amino-1-(4-C-azido-β-D-arabinofuranosyl)-2(1H)-pyrimidinone
- 2′-Deoxy-2′-beta-hydroxy-4′-azidocytidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
RO-9187
CAS:RO-9187 is an effective HCV virus replication inhibitor(IC50: 171 nM).Formula:C9H12N6O5Purity:98%Color and Shape:SolidMolecular weight:284.23RO-9187
CAS:RO-9187 is a modified oligonucleotide that inhibits the replication and spread of hepatitis B virus. It is a nucleoside analog with a deoxycytidine kinase-inhibiting activity. RO-9187 has shown antiviral activity in vitro and in vivo against the cell culture-grown hepatitis B virus, as well as against other viruses such as HIV and herpes simplex virus. The drug is pegylated to increase its plasma half-life and reduce renal clearance, making it more suitable for chronic use. RO-9187 has been shown to be active against viral strains that are resistant to other nucleosides analogs, including lamivudine, adefovir dipivoxil, entecavir, and telbivudine.
Formula:C9H12N6O5Purity:Min. 95%Molecular weight:284.23 g/molRef: 3D-BKB70803
Discontinued product

