CAS 876708-23-5

4-pyridin-3-yl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine

Description:

4-Pyridin-3-yl-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and imidazole rings. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, which contributes to its unique chemical properties. The presence of the pyridine moiety imparts basicity and potential for coordination with metal ions, while the imidazole component can participate in hydrogen bonding and exhibit aromatic characteristics. This compound is of interest in medicinal chemistry due to its potential biological activity, including antimicrobial and anticancer properties. Its solubility and stability can vary depending on the solvent and environmental conditions, making it relevant for various applications in drug development and synthesis. Additionally, the specific arrangement of substituents on the rings can influence its reactivity and interaction with biological targets, highlighting the importance of structural characteristics in determining the compound's functionality.

Formula: C₁₁H₁₂N₄

InChI: InChI=1/C11H12N4/c1-2-8(6-12-4-1)10-11-9(3-5-13-10)14-7-15-11/h1-2,4,6-7,10,13H,3,5H2,(H,14,15)

SMILES: c1cc(cnc1)C1c2c(CCN1)nc[nH]2

Synonyms:

• 1H-imidazo[4,5-c]pyridine, 4,5,6,7-tetrahydro-4-(3-pyridinyl)-
• 3H-imidazo[4,5-c]pyridine, 4,5,6,7-tetrahydro-4-(3-pyridinyl)-
• 4-(Pyridin-3-yl)-4,5,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine
• OTAVA-BB 1090320
• 3-{3H,4H,5H,6H,7H-Imidazo[4,5-c]pyridin-4-yl}pyridine
• 4-pyridin-3-yl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine(SALTDATA: FREE)
• 4-PYRIDIN-3-YL-4,5,6,7-TETRAHYDRO-3H-IMIDAZO[4,5-C]PYRIDINE