
CAS 876708-65-5
:5-Ethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid
Description:
5-Ethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a heterocyclic compound characterized by its unique pyrazolo-pyrimidine structure, which incorporates both a pyrazole and a pyrimidine ring. This compound features an ethyl group and a trifluoromethyl group, which contribute to its chemical properties and reactivity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, enhancing its solubility in polar solvents. The trifluoromethyl group is known for its electron-withdrawing properties, which can influence the compound's reactivity and stability. This substance may be of interest in medicinal chemistry due to its potential biological activity, particularly in the development of pharmaceuticals. Its specific interactions and applications would depend on further studies, including its synthesis, biological evaluation, and potential therapeutic uses. Overall, this compound exemplifies the complexity and diversity of heterocyclic chemistry, with implications in various fields, including drug discovery and materials science.
Formula:C10H8F3N3O2
InChI:InChI=1S/C10H8F3N3O2/c1-2-5-3-7(10(11,12)13)16-8(15-5)6(4-14-16)9(17)18/h3-4H,2H2,1H3,(H,17,18)
InChI key:InChIKey=XSTFRVOFOXGPBI-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N2C(=C(C(O)=O)C=N2)N=C(CC)C1
Synonyms:- 5-Ethyl-7-(trifluoromethyl)pyrazolo[1,5-a]pyrimidine-3-carboxylic acid
- Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 5-ethyl-7-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.