CAS 876709-30-7

5-(1H-imidazol-1-ylmethyl)furan-2-carboxylic acid

Description:

5-(1H-imidazol-1-ylmethyl)furan-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and an imidazole moiety. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often found in pharmaceuticals and biologically active compounds. The furan ring adds to the compound's aromatic character, which can influence its reactivity and interactions with other molecules. This substance may exhibit solubility in polar solvents due to the carboxylic acid group, while the aromatic rings can provide hydrophobic characteristics. Its molecular structure allows for potential hydrogen bonding, which can affect its stability and interactions in various environments. Overall, 5-(1H-imidazol-1-ylmethyl)furan-2-carboxylic acid is of interest in medicinal chemistry and may have applications in drug development or as a biochemical probe.

Formula: C₉H₈N₂O₃

InChI: InChI=1/C9H8N2O3/c12-9(13)8-2-1-7(14-8)5-11-4-3-10-6-11/h1-4,6H,5H2,(H,12,13)

SMILES: c1cc(C(=O)O)oc1Cn1ccnc1

Synonyms:

• 2-furancarboxylic acid, 5-(1H-imidazol-1-ylmethyl)-