CymitQuimica logo

CAS 876709-32-9

:

1-(piperidin-3-ylmethyl)pyrrolidin-2-one

Description:
1-(Piperidin-3-ylmethyl)pyrrolidin-2-one, identified by its CAS number 876709-32-9, is a chemical compound that belongs to the class of cyclic amines and lactams. This substance features a pyrrolidinone ring, which is a five-membered lactam, and a piperidine moiety, contributing to its structural complexity. The presence of both a piperidine and a pyrrolidinone suggests potential for various interactions, making it of interest in medicinal chemistry and drug development. The compound is likely to exhibit properties such as solubility in polar solvents, moderate lipophilicity, and potential biological activity, which may include effects on neurotransmitter systems due to the presence of nitrogen-containing rings. Its specific characteristics, including melting point, boiling point, and reactivity, would depend on the molecular environment and substituents. As with many compounds in this category, safety and handling precautions are essential, as they may exhibit toxicity or other hazardous properties. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications.
Formula:C10H18N2O
InChI:InChI=1/C10H18N2O/c13-10-4-2-6-12(10)8-9-3-1-5-11-7-9/h9,11H,1-8H2
InChI key:PNQLQOFVZKTDSF-UHFFFAOYSA-N
SMILES:C1CC(CNC1)CN1CCCC1=O
Synonyms:
  • 2-Pyrrolidinone, 1-(3-Piperidinylmethyl)-
Found 2 products.