CAS 876710-79-1
:1-(2-piperidin-2-ylethyl)pyrrolidin-2-one
Description:
1-(2-Piperidin-2-ylethyl)pyrrolidin-2-one, with the CAS number 876710-79-1, is a chemical compound that belongs to the class of cyclic amines and is characterized by its piperidine and pyrrolidinone moieties. This substance typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The presence of both piperidine and pyrrolidinone rings may contribute to its pharmacological properties, including potential effects on the central nervous system. Additionally, the compound may exhibit basic properties due to the nitrogen atoms in its structure, which can participate in hydrogen bonding and influence its reactivity. As with many organic compounds, safety and handling precautions are essential, as it may pose risks if ingested or improperly handled. Further studies would be necessary to fully elucidate its biological activity and potential therapeutic applications.
Formula:C11H20N2O
InChI:InChI=1/C11H20N2O/c14-11-5-3-8-13(11)9-6-10-4-1-2-7-12-10/h10,12H,1-9H2
SMILES:C1CCNC(C1)CCN1CCCC1=O
Synonyms:- 1-[2-(Piperidin-2-yl)ethyl]pyrrolidin-2-one
- 2-Pyrrolidinone, 1-[2-(2-piperidinyl)ethyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
