CAS 876715-59-2
:6-(2-methylpropyl)-2-oxo-1,2-dihydropyrimidine-4-carboxylic acid
Description:
6-(2-Methylpropyl)-2-oxo-1,2-dihydropyrimidine-4-carboxylic acid, with the CAS number 876715-59-2, is a chemical compound that belongs to the class of dihydropyrimidines, which are characterized by a six-membered ring containing nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the 2-oxo group indicates that it has a carbonyl functionality, which can participate in various chemical reactions, such as nucleophilic additions. The branched alkyl group (2-methylpropyl) attached to the nitrogen atom influences its solubility and steric properties, potentially affecting its biological activity and interactions. Dihydropyrimidines are often studied for their pharmacological properties, including their roles in medicinal chemistry as potential therapeutic agents. The specific structural features of this compound may confer unique properties, making it of interest in various fields, including drug development and organic synthesis.
Formula:C9H12N2O3
InChI:InChI=1/C9H12N2O3/c1-5(2)3-6-4-7(8(12)13)11-9(14)10-6/h4-5H,3H2,1-2H3,(H,12,13)(H,10,11,14)
SMILES:CC(C)Cc1cc(C(=O)O)nc(n1)O
Synonyms:- 2-Hydroxy-6-Isobutylpyrimidine-4-Carboxylic Acid
- 4-Pyrimidinecarboxylic Acid, 2-Hydroxy-6-(2-Methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
