CAS 876715-66-1

1-amino-3-(2,4-dimethylphenoxy)propan-2-ol

Description:

1-Amino-3-(2,4-dimethylphenoxy)propan-2-ol is an organic compound characterized by its amino alcohol structure, which features an amino group (-NH2) and a hydroxyl group (-OH) attached to a propanol backbone. The presence of the 2,4-dimethylphenoxy group indicates that the compound has a phenolic moiety with two methyl substituents on the aromatic ring, contributing to its hydrophobic characteristics. This compound is likely to exhibit moderate solubility in polar solvents due to the hydroxyl group while maintaining some hydrophobic interactions due to the aromatic portion. Its amino group may participate in hydrogen bonding, enhancing its reactivity and potential applications in pharmaceuticals or as a chemical intermediate. The compound's specific properties, such as melting point, boiling point, and reactivity, would depend on its molecular interactions and the steric effects of the substituents. Overall, 1-amino-3-(2,4-dimethylphenoxy)propan-2-ol is a versatile compound with potential applications in various chemical and biological contexts.

Formula: C₁₁H₁₇NO₂

InChI: InChI=1/C11H17NO2/c1-8-3-4-11(9(2)5-8)14-7-10(13)6-12/h3-5,10,13H,6-7,12H2,1-2H3

SMILES: Cc1ccc(c(C)c1)OCC(CN)O

Synonyms:

• 2-Propanol, 1-Amino-3-(2,4-Dimethylphenoxy)-
• 1-Amino-3-(2,4-dimethylphenoxy)propan-2-ol

1-Amino-3-(2,4-dimethyl-phenoxy)-propan-2-ol

CAS: 876715-66-1

Formula: C₁₁H₁₇NO₂

Molecular weight: 195.2582

Ref: IN-DA008E1U

1-Amino-3-(2,4-dimethylphenoxy)propan-2-ol

CAS: 876715-66-1

1-Amino-3-(2,4-dimethylphenoxy)propan-2-ol

Purity: ≥95%

Molecular weight: 195.26g/mol

Ref: 54-OR322646