CymitQuimica logo

CAS 876716-01-7

:

N-methyl-1-[1-(1-methylethyl)piperidin-3-yl]methanamine

Description:
N-methyl-1-[1-(1-methylethyl)piperidin-3-yl]methanamine, with the CAS number 876716-01-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with a branched alkyl group and a methylamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the isopropyl group contributes to its steric bulk, potentially affecting its biological activity and interaction with receptors. As a tertiary amine, it may participate in various chemical reactions, including alkylation and acylation. The compound's specific applications and behavior in biological systems would depend on its interaction with biological targets, making it of interest in medicinal chemistry and pharmacology. Safety and handling considerations should be taken into account, as with any chemical substance, particularly regarding its potential toxicity and environmental impact.
Formula:C10H22N2
InChI:InChI=1/C10H22N2/c1-9(2)12-6-4-5-10(8-12)7-11-3/h9-11H,4-8H2,1-3H3
SMILES:CC(C)N1CCCC(CNC)C1
Synonyms:
  • 3-piperidinemethanamine, N-methyl-1-(1-methylethyl)-
  • N-methyl-1-[1-(propan-2-yl)piperidin-3-yl]methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.