CAS 876716-16-4

2-(2-fluorophenyl)-2-pyrrolidin-1-ylethanamine

Description:

2-(2-Fluorophenyl)-2-pyrrolidin-1-ylethanamine, identified by its CAS number 876716-16-4, is a chemical compound that belongs to the class of substituted phenylpyrrolidines. This substance features a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, and a fluorophenyl group, indicating the presence of a fluorine atom on the phenyl ring. The compound is characterized by its potential biological activity, often studied in the context of pharmacology and medicinal chemistry. Its structure suggests it may interact with various neurotransmitter systems, making it of interest for research into neuropharmacological applications. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in drug design. Additionally, the compound's properties, such as solubility, melting point, and reactivity, would be influenced by its specific molecular structure and functional groups. As with many compounds in this category, safety and handling precautions are essential due to potential biological effects.

Formula: C₁₂H₁₇FN₂

InChI: InChI=1/C12H17FN2/c13-11-6-2-1-5-10(11)12(9-14)15-7-3-4-8-15/h1-2,5-6,12H,3-4,7-9,14H2

SMILES: c1ccc(c(c1)C(CN)N1CCCC1)F

Synonyms:

• 1-Pyrrolidineethanamine, beta-(2-fluorophenyl)-
• 2-(2-Fluorophenyl)-2-(Pyrrolidin-1-Yl)Ethan-1-Amine
• 2-(2-Fluorophenyl)-2-(pyrrolidin-1-yl)ethanamine