CAS 876716-32-4

(5-methyl-1H-tetrazol-1-yl)(phenyl)acetic acid

Description:

(5-methyl-1H-tetrazol-1-yl)(phenyl)acetic acid is a chemical compound characterized by its unique structure, which includes a tetrazole ring and a phenylacetic acid moiety. The presence of the tetrazole ring contributes to its potential biological activity, as tetrazoles are known for their role in pharmaceuticals and agrochemicals. This compound typically exhibits properties such as moderate solubility in polar solvents, which is common for carboxylic acids, and it may display acidic behavior due to the carboxylic acid functional group. The phenyl group can enhance lipophilicity, potentially influencing the compound's interaction with biological membranes. Additionally, the methyl substitution on the tetrazole ring may affect the compound's reactivity and stability. Overall, (5-methyl-1H-tetrazol-1-yl)(phenyl)acetic acid is of interest in medicinal chemistry and may serve as a scaffold for the development of new therapeutic agents. Its specific applications and biological activities would depend on further research and characterization.

Formula: C₁₀H₁₀N₄O₂

InChI: InChI=1/C10H10N4O2/c1-7-11-12-13-14(7)9(10(15)16)8-5-3-2-4-6-8/h2-6,9H,1H3,(H,15,16)

SMILES: Cc1nnnn1C(c1ccccc1)C(=O)O

Synonyms:

• 1H-tetrazole-1-acetic acid, 5-methyl-alpha-phenyl-