CAS 876716-43-7
:1-Cyclopropyl-5-oxopyrrolidine-3-carboxylic acid
Description:
1-Cyclopropyl-5-oxopyrrolidine-3-carboxylic acid is a chemical compound characterized by its unique bicyclic structure, which includes a cyclopropyl group and a pyrrolidine ring. The presence of a carbonyl group (ketone) at the 5-position and a carboxylic acid functional group at the 3-position contributes to its reactivity and potential biological activity. This compound may exhibit properties typical of both cyclic amines and carboxylic acids, such as the ability to participate in hydrogen bonding and form salts. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The cyclopropyl moiety can influence the compound's lipophilicity and steric properties, which are important for its interaction with biological targets. Additionally, the compound's stability, solubility, and reactivity can be influenced by the presence of functional groups and the overall molecular conformation. As with many such compounds, further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C8H11NO3
InChI:InChI=1/C8H11NO3/c10-7-3-5(8(11)12)4-9(7)6-1-2-6/h5-6H,1-4H2,(H,11,12)
SMILES:C1CC1N1CC(CC1=O)C(=O)O
Synonyms:- 3-Pyrrolidinecarboxylic acid, 1-cyclopropyl-5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
