CymitQuimica logo

CAS 876716-55-1

:

[(6-methyl-1H-benzimidazol-2-yl)methoxy]acetic acid

Description:
The chemical substance known as [(6-methyl-1H-benzimidazol-2-yl)methoxy]acetic acid, with the CAS number 876716-55-1, is characterized by its unique structural features that include a benzimidazole core substituted with a methyl group and a methoxy group, along with an acetic acid moiety. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The benzimidazole ring contributes to its potential biological activity, often associated with pharmacological properties. The presence of the methoxy group may enhance lipophilicity, influencing the compound's absorption and distribution in biological systems. Additionally, the compound may exhibit acidic behavior due to the carboxylic acid group, which can dissociate in aqueous solutions. Overall, this substance may be of interest in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways or receptors.
Formula:C11H12N2O3
InChI:InChI=1/C11H12N2O3/c1-7-2-3-8-9(4-7)13-10(12-8)5-16-6-11(14)15/h2-4H,5-6H2,1H3,(H,12,13)(H,14,15)
SMILES:Cc1ccc2c(c1)[nH]c(COCC(=O)O)n2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.