CAS 876716-61-9

(tetrahydro-2H-pyran-2-ylmethoxy)acetic acid

Description:

(tetrahydro-2H-pyran-2-ylmethoxy)acetic acid, identified by its CAS number 876716-61-9, is an organic compound characterized by its unique structure that includes a tetrahydro-pyran ring and a methoxy group attached to an acetic acid moiety. This compound typically exhibits properties associated with both ethers and carboxylic acids, which may influence its solubility and reactivity. The presence of the tetrahydro-pyran ring suggests potential for ring-opening reactions under certain conditions, while the carboxylic acid functional group can participate in acid-base reactions and esterification processes. Its molecular structure may also confer specific biological activities, making it of interest in medicinal chemistry. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and environmental conditions. As with many organic compounds, its stability and reactivity can be influenced by factors such as temperature, pH, and the presence of catalysts or other reagents.

Formula: C₈H₁₄O₄

InChI: InChI=1/C8H14O4/c9-8(10)6-11-5-7-3-1-2-4-12-7/h7H,1-6H2,(H,9,10)

SMILES: C1CCOC(C1)COCC(=O)O

(Tetrahydro-2H-pyran-2-ylmethoxy)acetic acid

CAS: 876716-61-9

Versatile small molecule scaffold

Formula: C₈H₁₄O₄

Purity: Min. 95%

Molecular weight: 174.19 g/mol

Ref: 3D-BKB71661