CAS 876717-41-8
:2-(2-methoxyethyl)pyrimidine-5-carbaldehyde
Description:
2-(2-Methoxyethyl)pyrimidine-5-carbaldehyde is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features a carbaldehyde functional group (-CHO) at the 5-position of the pyrimidine ring, contributing to its reactivity and potential applications in organic synthesis. The presence of a 2-methoxyethyl substituent enhances its solubility in organic solvents and may influence its biological activity. Typically, compounds like this are of interest in medicinal chemistry and material science due to their potential as intermediates in the synthesis of pharmaceuticals or agrochemicals. The molecular structure suggests that it may participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, the compound's properties, such as boiling point, melting point, and solubility, would be influenced by the functional groups present and the overall molecular architecture. Safety and handling precautions should be observed, as with any chemical substance, particularly those with reactive functional groups.
Formula:C8H10N2O2
InChI:InChI=1/C8H10N2O2/c1-12-3-2-8-9-4-7(6-11)5-10-8/h4-6H,2-3H2,1H3
SMILES:COCCc1ncc(cn1)C=O
Synonyms:- 2-(2-Methoxy-ethyl)-pyrimidine-5-carbaldehyde
- 5-Pyrimidinecarboxaldehyde, 2-(2-Methoxyethyl)-
- 2-(2-Methoxyethyl)pyrimidine-5-carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-(2-Methoxyethyl)pyrimidine-5-carbaldehyde
CAS:2-(2-Methoxyethyl)pyrimidine-5-carbaldehyde is a modified nucleoside that has been shown to be an effective antiviral and anticancer agent. This compound inhibits viral replication by blocking the synthesis of viral DNA, and also exhibits cytotoxic activity against cancer cells. 2-(2-Methoxyethyl)pyrimidine-5-carbaldehyde is an activator of ribonucleotide reductase and deoxyribonucleotide reductase and can be used in the synthesis of nucleosides, DNA, or phosphoramidites.Formula:C8H10N2O2Purity:Min. 95%Molecular weight:166.18 g/mol
