CAS 876717-57-6
:2,3-Dihydro-α,2-dimethyl-3-oxo-4H-1,4-benzoxazine-4-acetic acid
Description:
2,3-Dihydro-α,2-dimethyl-3-oxo-4H-1,4-benzoxazine-4-acetic acid is a chemical compound characterized by its unique structure, which includes a benzoxazine ring fused with a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and stability. The presence of the dimethyl and keto groups suggests that it may participate in various chemical reactions, including condensation and substitution reactions. Its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry and drug development. Additionally, the compound's solubility and stability can be influenced by the functional groups present, which may affect its application in various fields, including pharmaceuticals and materials science. As with many organic compounds, the specific characteristics such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C12H13NO4
InChI:InChI=1S/C12H13NO4/c1-7(12(15)16)13-9-5-3-4-6-10(9)17-8(2)11(13)14/h3-8H,1-2H3,(H,15,16)
InChI key:InChIKey=TYKNSYRLVRTNBF-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C)N1C=2C(OC(C)C1=O)=CC=CC2
Synonyms:- 2,3-Dihydro-α,2-dimethyl-3-oxo-4H-1,4-benzoxazine-4-acetic acid
- 4H-1,4-Benzoxazine-4-acetic acid, 2,3-dihydro-α,2-dimethyl-3-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.