CAS 876721-02-7

2,6,8-trimethylquinoline-3-carboxylic acid

Description:

2,6,8-Trimethylquinoline-3-carboxylic acid is an organic compound belonging to the quinoline family, characterized by a fused bicyclic structure containing a nitrogen atom. This compound features three methyl groups at the 2, 6, and 8 positions of the quinoline ring, contributing to its unique properties. The presence of a carboxylic acid functional group at the 3-position enhances its acidity and solubility in polar solvents. Typically, compounds like this exhibit moderate to high stability under standard conditions, although they may be sensitive to strong oxidizing agents. The methyl groups can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological systems. Additionally, derivatives of quinoline compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, and as fluorescent probes due to their ability to interact with various biological targets. Overall, 2,6,8-trimethylquinoline-3-carboxylic acid represents a structurally interesting compound with potential utility in various chemical and biological contexts.

Formula: C₁₃H₁₃NO₂

InChI: InChI=1/C13H13NO2/c1-7-4-8(2)12-10(5-7)6-11(13(15)16)9(3)14-12/h4-6H,1-3H3,(H,15,16)

Synonyms:

• 3-quinolinecarboxylic acid, 2,6,8-trimethyl-
• 2,6,8-Trimethylquinoline-3-carboxylic acid