CAS 876728-42-6

4-[2-(trifluoromethyl)-1H-benzimidazol-1-yl]butanoic acid

Description:

4-[2-(Trifluoromethyl)-1H-benzimidazol-1-yl]butanoic acid is a chemical compound characterized by its unique structure, which includes a benzimidazole moiety substituted with a trifluoromethyl group and a butanoic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's interaction with biological targets. The benzimidazole ring is known for its role in various pharmacological activities, including antimicrobial and anti-inflammatory effects. As a carboxylic acid, it can participate in acid-base reactions and form salts or esters. The compound's solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. Overall, 4-[2-(trifluoromethyl)-1H-benzimidazol-1-yl]butanoic acid is of interest in medicinal chemistry and may have applications in drug development, particularly in targeting specific biological pathways.

Formula: C₁₂H₁₁F₃N₂O₂

InChI: InChI=1/C12H11F3N2O2/c13-12(14,15)11-16-8-4-1-2-5-9(8)17(11)7-3-6-10(18)19/h1-2,4-5H,3,6-7H2,(H,18,19)

SMILES: c1ccc2c(c1)nc(C(F)(F)F)n2CCCC(=O)O

Synonyms:

• 1H-benzimidazole-1-butanoic acid, 2-(trifluoromethyl)-
• 4-[2-(TRIFLUOROMETHYL)-1H-BENZIMIDAZOL-1-YL]BUTANOIC ACID

4-[2-(Trifluoromethyl)-1H-benzimidazol-1-yl]butanoic acid

CAS: 876728-42-6

4-[2-(Trifluoromethyl)-1H-benzimidazol-1-yl]butanoic acid

Purity: 97%

Molecular weight: 272.22g/mol

Ref: 54-PC4592