CAS 876742-91-5

Methyl 1-ethyl-3-formyl-1H-indole-6-carboxylate

Description:

Methyl 1-ethyl-3-formyl-1H-indole-6-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a carboxylate group, an ethyl group, and a formyl group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the formyl group indicates that it can participate in various chemical reactions, such as condensation and oxidation. The methyl ester functional group enhances its solubility in organic solvents, making it suitable for various chemical reactions and applications. Additionally, compounds with indole structures are often studied for their biological activities, including antimicrobial and anticancer properties. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, Methyl 1-ethyl-3-formyl-1H-indole-6-carboxylate represents a versatile building block in organic chemistry.

Formula: C₁₃H₁₃NO₃

InChI: InChI=1S/C13H13NO3/c1-3-14-7-10(8-15)11-5-4-9(6-12(11)14)13(16)17-2/h4-8H,3H2,1-2H3

InChI key: InChIKey=QIBQCLSEIBGUGH-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(C(C=O)=C1)=CC=C(C(OC)=O)C2

Synonyms:

• 1H-Indole-6-carboxylic acid, 1-ethyl-3-formyl-, methyl ester
• Methyl 1-ethyl-3-formyl-1H-indole-6-carboxylate
• 1-Ethyl-3-formyl-1H-indole-6-carboxylic acid methyl ester