CymitQuimica logo

CAS 87676-07-1

:

N-(2-Methoxy-1-methylethyl)-2,4-dimethyl-3-thiophenamine

Description:
N-(2-Methoxy-1-methylethyl)-2,4-dimethyl-3-thiophenamine, identified by its CAS number 87676-07-1, is an organic compound that features a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound is characterized by its amine functional group, which can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. The presence of the methoxy and dimethyl groups contributes to its hydrophobic properties and may influence its solubility and reactivity. Additionally, the structure suggests potential applications in pharmaceuticals or agrochemicals, as compounds with thiophene moieties often exhibit biological activity. The compound's molecular structure may also impart specific electronic properties, making it of interest in materials science or organic electronics. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, this compound exemplifies the diverse chemistry associated with thiophene derivatives and their potential utility in various fields.
Formula:C10H17NOS
InChI:InChI=1S/C10H17NOS/c1-7-6-13-9(3)10(7)11-8(2)5-12-4/h6,8,11H,5H2,1-4H3
InChI key:InChIKey=MKTFWDHZGUUGQZ-UHFFFAOYSA-N
SMILES:N(C(COC)C)C=1C(C)=CSC1C
Synonyms:
  • 3-Thiophenamine, N-(2-methoxy-1-methylethyl)-2,4-dimethyl-
  • N-(2-Methoxy-1-methylethyl)-2,4-dimethyl-3-thiophenamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.