CymitQuimica logo

CAS 87679-21-8

:

(2S,3aR,6aR)-octahydrocyclopenta[b]pyrrole-2-carboxylic acid

Description:
(2S,3aR,6aR)-octahydrocyclopenta[b]pyrrole-2-carboxylic acid is a bicyclic compound characterized by its unique fused ring structure, which includes a pyrrole moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The stereochemistry indicated by the (2S,3aR,6aR) notation suggests specific spatial arrangements of its atoms, which can influence its biological activity and interactions with other molecules. Typically, compounds like this may exhibit properties such as solubility in polar solvents due to the presence of the carboxylic acid group, and they may participate in hydrogen bonding. The structural complexity of this compound may also suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as many biologically active compounds contain similar bicyclic frameworks. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications and behavior in various environments.
Formula:C8H13NO2
InChI:InChI=1/C8H13NO2/c10-8(11)7-4-5-2-1-3-6(5)9-7/h5-7,9H,1-4H2,(H,10,11)/t5-,6-,7+/m1/s1
Synonyms:
  • (2α,3aα,6aα)-Octahydro-cyclopenta[b]pyrrole-2-carboxylic Acid
  • Cyclopenta[b]pyrrole-2-carboxylic acid, octahydro-, (2-alpha-,3a-alpha-,6a-alpha-)- (9CI)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.