CAS 876881-48-0

5-(1H-indol-1-ylmethyl)furan-2-carboxylic acid

Description:

5-(1H-indol-1-ylmethyl)furan-2-carboxylic acid is a chemical compound characterized by its unique structure, which combines an indole moiety with a furan ring and a carboxylic acid functional group. This compound typically exhibits properties associated with both indole and furan derivatives, such as potential biological activity and solubility in organic solvents. The presence of the carboxylic acid group suggests it can participate in acid-base reactions and may form salts or esters. Its indole structure is often linked to various pharmacological activities, including anti-inflammatory and anticancer properties. The compound may also engage in hydrogen bonding due to the carboxylic acid, influencing its interactions in biological systems. Additionally, the specific arrangement of atoms and functional groups can affect its reactivity, stability, and potential applications in medicinal chemistry or material science. Overall, 5-(1H-indol-1-ylmethyl)furan-2-carboxylic acid represents a versatile scaffold for further chemical modifications and investigations in various fields of research.

Formula: C₁₄H₁₁NO₃

InChI: InChI=1/C14H11NO3/c16-14(17)13-6-5-11(18-13)9-15-8-7-10-3-1-2-4-12(10)15/h1-8H,9H2,(H,16,17)

SMILES: c1ccc2c(c1)ccn2Cc1ccc(C(=O)O)o1

Synonyms:

• 2-furancarboxylic acid, 5-(1H-indol-1-ylmethyl)-
• 5-(1H-indol-1-ylmethyl)-2-furoic acid