CymitQuimica logo

CAS 87694-49-3

:

N-(tert-butoxycarbonyl)-L-alanine N'-methoxy-N'-Methylamide

Description:
N-(tert-butoxycarbonyl)-L-alanine N'-methoxy-N'-methylamide, with the CAS number 87694-49-3, is a chemical compound that belongs to the class of amino acid derivatives. This substance features a tert-butoxycarbonyl (Boc) protecting group, which is commonly used in peptide synthesis to protect the amino group of the amino acid. The presence of the methoxy and methylamide groups indicates that it has additional functional modifications that can influence its reactivity and solubility. Typically, compounds like this are utilized in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules. The structure suggests it may exhibit specific interactions due to its polar functional groups, which can affect its solubility in various solvents. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance provided by the tert-butoxycarbonyl group. Overall, this compound is significant in synthetic chemistry, especially in the context of peptide and drug development.
Formula:C10H20N2O4
InChI:InChI=1/C10H20N2O4/c1-7(8(13)12(5)15-6)11-9(14)16-10(2,3)4/h7H,1-6H3,(H,11,14)
InChI key:PWQIGBOSLQHOBT-UHFFFAOYSA-N
SMILES:CC(C(=O)N(C)OC)N=C(O)OC(C)(C)C
Synonyms:
  • N~2~-(tert-butoxycarbonyl)-N-methoxy-N-methylalaninamide
  • Boc-Ala-N(OCH3)CH3
  • N-(tert-Butoxycarbonyl)-L-alanine N-methoxy-N-methylamide
Found 6 products.