CAS 877-03-2
:5-Bromoindole-3-carboxaldehyde
Description:
5-Bromoindole-3-carboxaldehyde is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 5-position and an aldehyde functional group at the 3-position distinguishes this compound. It typically appears as a solid or crystalline substance and is known for its reactivity due to the aldehyde group, which can participate in various chemical reactions, including condensation and nucleophilic addition. This compound is often utilized in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals and biologically active molecules. Its properties, such as solubility and stability, can vary depending on the solvent and environmental conditions. Additionally, 5-Bromoindole-3-carboxaldehyde may exhibit fluorescence, making it useful in certain analytical applications. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C9H6BrNO
InChI:InChI=1S/C9H6BrNO/c10-7-1-2-9-8(3-7)6(5-12)4-11-9/h1-5,11H
InChI key:InChIKey=PEENKJZANBYXNB-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=CC=C(Br)C2
Synonyms:- 1H-Indole-3-carboxaldehyde, 5-bromo-
- 5-Bromo-1H-indole-3-carbaldehyde
- 5-Bromo-1H-indole-3-carboxaldehyde
- 5-Bromo-3-formylindole
- 5-Bromoindole-3-carbaldehyde
- Indole-3-carboxaldehyde, 5-bromo-
- NSC 66831
- 5-Bromoindole-3-carboxaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Bromoindole-3-carboxaldehyde
CAS:Formula:C9H6BrNOPurity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:224.065-Bromoindole-3-carboxaldehyde
CAS:Formula:C9H6BrNOPurity:98%Color and Shape:SolidMolecular weight:224.05405-Bromo-1H-indole-3-carboxaldehyde
CAS:5-Bromo-1H-indole-3-carboxaldehydeFormula:C9H6BrNOPurity:98%Color and Shape: faint brown powderMolecular weight:224.05g/mol5-Bromoindole-3-carboxaldehyde
CAS:5-Bromoindole-3-carboxaldehyde is a water molecule that has been crystallized in the form of an amide. It is a chemical substance with asymmetric synthesis and significant antifungal activity. 5-Bromoindole-3-carboxaldehyde is active against some strains of the fungus Candida albicans and has been shown to inhibit the growth of kidney cells. This molecule also binds to the neurokinin 1 receptor and is used as a probe for fluorescence studies. The efficient method for synthesizing 5-Bromoindole-3-carboxaldehyde includes using silico analysis to confirm the structure on a computer, then performing an asymmetric synthesis with an acid catalyst to produce this compound.
Formula:C9H6BrNOPurity:Min. 98 Area-%Color and Shape:PowderMolecular weight:224.05 g/mol5-Bromoindole-3-carboxaldehyde
CAS:Formula:C9H6BrNOPurity:98%Color and Shape:SolidMolecular weight:224.057





