CAS 877-24-7: Potassium hydrogen phthalate

Description:Potassium hydrogen phthalate (KHP), with the CAS number 877-24-7, is a white, crystalline solid that is commonly used as a primary standard in acid-base titrations due to its stability and non-hygroscopic nature. It is the potassium salt of phthalic acid and has the chemical formula KHC8H4O4. KHP is soluble in water, making it suitable for preparing standard solutions, and it has a relatively high melting point. The substance is often utilized in analytical chemistry for calibrating pH meters and determining the concentration of bases. KHP exhibits acidic properties, as it can donate a proton (H+) in solution, which is essential for its role in titrations. Additionally, it is non-toxic and environmentally friendly, making it a preferred choice in laboratory settings. Its molecular structure includes a phthalate group, which contributes to its chemical behavior and interactions. Overall, potassium hydrogen phthalate is a valuable reagent in quantitative analysis and educational laboratories.

Formula:C₈H₆O₄·K

InChI:InChI=1S/C8H6O4.K/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);

InChI key:InChIKey=XCCFSZODNJHPEF-UHFFFAOYSA-N

SMILES:[K].O=C(O)C=1C=CC=CC1C(=O)O