CAS 877-52-1
:2-(2-Chlorophenyl)hydrazinecarbothioamide
Description:
2-(2-Chlorophenyl)hydrazinecarbothioamide, with the CAS number 877-52-1, is an organic compound characterized by the presence of a hydrazine functional group and a thioamide moiety. This compound features a chlorophenyl group, which contributes to its aromatic properties and potential reactivity. Typically, thioamides exhibit distinct chemical behavior compared to their amide counterparts, often displaying enhanced nucleophilicity due to the presence of sulfur. The chlorophenyl substituent can influence the compound's solubility, stability, and reactivity, making it of interest in various chemical applications, including medicinal chemistry and agrochemicals. The presence of the hydrazine group suggests potential for forming coordination complexes and participating in redox reactions. Additionally, compounds like this may exhibit biological activity, which warrants investigation for potential pharmaceutical applications. Safety data should be consulted, as compounds containing hydrazine derivatives can be hazardous. Overall, 2-(2-Chlorophenyl)hydrazinecarbothioamide is a compound of interest in both synthetic and applied chemistry contexts.
Formula:C7H8ClN3S
InChI:InChI=1S/C7H8ClN3S/c8-5-3-1-2-4-6(5)10-11-7(9)12/h1-4,10H,(H3,9,11,12)
InChI key:InChIKey=FBZHHNIYVSQVLR-UHFFFAOYSA-N
SMILES:N(NC(N)=S)C1=C(Cl)C=CC=C1
Synonyms:- 2-(2-Chlorophenyl)hydrazinecarbothioamide
- [(2-Chlorophenyl)amino]thiourea
- Hydrazinecarbothioamide, 2-(2-chlorophenyl)-
- 1-(2-Chloro-phenyl)-thiosemicarbazide
- Semicarbazide, 1-(o-chlorophenyl)-3-thio-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
