CAS 877-67-8
:4-(hydroxyamino)benzenesulfonamide
Description:
4-(Hydroxyamino)benzenesulfonamide, also known as sulfanilamide, is an organic compound characterized by the presence of a sulfonamide group attached to a benzene ring that also contains a hydroxyamino functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in water, which is a notable feature of sulfonamides due to their polar sulfonamide group. The presence of the hydroxyamino group contributes to its reactivity, allowing it to participate in various chemical reactions, including those involving nucleophilic substitution. 4-(Hydroxyamino)benzenesulfonamide has applications in medicinal chemistry, particularly as an antibacterial agent, due to its ability to inhibit bacterial growth by interfering with folic acid synthesis. Additionally, it may be used in the synthesis of other chemical compounds and as a reagent in various analytical methods. Safety precautions should be observed when handling this compound, as with many sulfonamides, due to potential allergic reactions and other health risks associated with exposure.
Formula:C6H8N2O3S
InChI:InChI=1/C6H8N2O3S/c7-12(10,11)6-3-1-5(8-9)2-4-6/h1-4,8-9H,(H2,7,10,11)
SMILES:c1cc(ccc1NO)S(=O)(=O)N
Synonyms:- 4-(Hydroxyamino)benzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
