CAS 877-79-2

Benzenamine, N,N-dimethyl-4-[(methylimino)methyl]-

Description:

Benzenamine, N,N-dimethyl-4-[(methylimino)methyl]- is an organic compound characterized by its amine functional groups and aromatic structure. It features a benzene ring substituted with a dimethylamino group and a methylimino group, which contributes to its reactivity and potential applications in various chemical processes. The presence of the methylimino group indicates that this compound can participate in nucleophilic reactions, making it useful in organic synthesis. Its molecular structure suggests that it may exhibit properties typical of both amines and aromatic compounds, such as basicity and potential for hydrogen bonding. Additionally, the compound's solubility and stability can be influenced by the presence of the dimethylamino group, which can enhance its solubility in polar solvents. As with many amines, it may also have implications in biological systems, although specific biological activity would require further investigation. Overall, this compound's unique structure positions it as a candidate for various applications in chemical research and industry.

Formula: C₁₀H₁₄N₂

InChI: InChI=1S/C10H14N2/c1-11-8-9-4-6-10(7-5-9)12(2)3/h4-8H,1-3H3

InChI key: VKLCQRQREREZTC-UHFFFAOYSA-N

SMILES: CN=CC1=CC=C(C=C1)N(C)C