CAS 87700-61-6
:6-Methyl-2-naphthalenecarbonyl chloride
Description:
6-Methyl-2-naphthalenecarbonyl chloride, with the CAS number 87700-61-6, is an organic compound characterized by its naphthalene structure, which consists of two fused aromatic rings. The presence of a carbonyl chloride functional group (–C(=O)Cl) indicates that it is an acyl chloride, making it reactive and useful in various chemical reactions, particularly in acylation processes. The methyl group at the 6-position of the naphthalene ring contributes to its unique reactivity and steric properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is important to handle this substance with care due to its potential reactivity, especially with water, which can lead to the release of hydrochloric acid. In synthetic organic chemistry, 6-Methyl-2-naphthalenecarbonyl chloride can be utilized as an intermediate in the synthesis of various pharmaceuticals, agrochemicals, and other organic compounds. Proper safety measures should be observed when working with this compound due to its corrosive nature.
Formula:C12H9ClO
InChI:InChI=1S/C12H9ClO/c1-8-2-3-10-7-11(12(13)14)5-4-9(10)6-8/h2-7H,1H3
InChI key:InChIKey=KVOLELHENSPYLS-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=CC2=C(C=C(C)C=C2)C=C1
Synonyms:- 6-Methyl-2-naphthoyl chloride
- 2-Naphthalenecarbonyl chloride, 6-methyl-
- 6-Methyl-2-naphthalenecarbonyl chloride
- 6-Methyl-2-naphthoylchloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.