CAS 877060-55-4

1,1-Dimethylethyl 3-formyl-1H-pyrrolo[3,2-c]pyridine-1-carboxylate

Description:

1,1-Dimethylethyl 3-formyl-1H-pyrrolo[3,2-c]pyridine-1-carboxylate, identified by its CAS number 877060-55-4, is a chemical compound characterized by its unique structural features, which include a pyrrolopyridine core. This compound typically exhibits a carboxylate functional group and an aldehyde group, contributing to its reactivity and potential applications in organic synthesis. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric properties, which can influence its interaction with other molecules. The compound may display biological activity, making it of interest in medicinal chemistry and drug development. Its solubility and stability can vary depending on the solvent and conditions, which is crucial for its practical applications. Additionally, the compound's synthesis may involve various organic reactions, including condensation and functional group transformations, highlighting its versatility in chemical research. Overall, this compound represents a fascinating area of study within the field of organic chemistry, particularly for those exploring novel pyridine derivatives.

Formula: C₁₃H₁₄N₂O₃

InChI: InChI=1S/C13H14N2O3/c1-13(2,3)18-12(17)15-7-9(8-16)10-6-14-5-4-11(10)15/h4-8H,1-3H3

InChI key: InChIKey=WDRSHMWGKULOGC-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1C=2C(C(C=O)=C1)=CN=CC2

Synonyms:

• 1,1-Dimethylethyl 3-formyl-1H-pyrrolo[3,2-c]pyridine-1-carboxylate
• 1H-Pyrrolo[3,2-c]pyridine-1-carboxylic acid, 3-formyl-, 1,1-dimethylethyl ester

tert-Butyl 3-formyl-1H-pyrrolo[3,2-c]pyridine-1-carboxylate

CAS: 877060-55-4

Versatile small molecule scaffold

Formula: C₁₃H₁₄N₂O₃

Purity: Min. 95%

Molecular weight: 246.26 g/mol

Ref: 3D-CKB06055