
CAS 877062-41-4
:N-[(2S)-2,3-Dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-yl]-2-propanesulfonamide
Description:
N-[(2S)-2,3-Dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-yl]-2-propanesulfonamide, with CAS number 877062-41-4, is a chemical compound characterized by its complex structure, which includes a sulfonamide functional group and a boron-containing moiety. The presence of the dioxaborolane ring suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions or as a reagent in synthetic organic chemistry. The compound's stereochemistry, indicated by the (2S) configuration, implies specific spatial arrangements that can influence its reactivity and interactions with biological targets. Additionally, the sulfonamide group is known for its pharmacological properties, often contributing to the compound's solubility and biological activity. Overall, this compound's unique structural features may render it useful in medicinal chemistry, particularly in the development of new therapeutic agents or as a tool in chemical biology. Further studies would be necessary to elucidate its specific properties and potential applications.
Formula:C18H28BNO4S
InChI:InChI=1S/C18H28BNO4S/c1-12(2)25(21,22)20-16-10-13-7-8-15(9-14(13)11-16)19-23-17(3,4)18(5,6)24-19/h7-9,12,16,20H,10-11H2,1-6H3/t16-/m0/s1
InChI key:InChIKey=JLOLHMBPRDBUNQ-INIZCTEOSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C3C(=CC2)C[C@H](NS(C(C)C)(=O)=O)C3
Synonyms:- (S)-N-[5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-2-yl]propane-2-sulfonamide
- N-[(2S)-5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-2-yl]-2-propanesulfonamide
- 2-Propanesulfonamide, N-[(2S)-2,3-dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-yl]-
- N-[(2S)-2,3-Dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-yl]-2-propanesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Propanesulfonamide, N-[(2S)-2,3-dihydro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-inden-2-yl]-
CAS:Formula:C18H28BNO4SMolecular weight:365.2952
