
CAS 877133-46-5
:Ethyl β-ethenyl-β-hydroxycyclopentanepropanoate
Description:
Ethyl β-ethenyl-β-hydroxycyclopentanepropanoate, identified by its CAS number 877133-46-5, is an organic compound characterized by its unique structure that includes a cyclopentane ring, an ethylene group, and an ester functional group. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid with a pleasant odor. It is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic cyclopentane component. The presence of the β-hydroxy group suggests potential for hydrogen bonding, which can influence its reactivity and interactions with other molecules. Ethyl β-ethenyl-β-hydroxycyclopentanepropanoate may be of interest in various applications, including organic synthesis and as a potential intermediate in the production of more complex chemical entities. Its specific reactivity and stability would depend on the conditions of use, including temperature and the presence of catalysts or other reagents.
Formula:C12H20O3
InChI:InChI=1S/C12H20O3/c1-3-12(14,9-11(13)15-4-2)10-7-5-6-8-10/h3,10,14H,1,4-9H2,2H3
InChI key:InChIKey=WNJPLRDTAROUFY-UHFFFAOYSA-N
SMILES:C(CC(OCC)=O)(C=C)(O)C1CCCC1
Synonyms:- Cyclopentanepropanoic acid, β-ethenyl-β-hydroxy-, ethyl ester
- Ethyl β-ethenyl-β-hydroxycyclopentanepropanoate
- Ethyl 3-cyclopentyl-3-hydroxypent-4-enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.