CAS 877134-77-5

1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea

Description:

1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea, with the CAS number 877134-77-5, is a chemical compound that features a urea functional group linked to a phenyl ring, which is further substituted with a boron-containing moiety. This compound is characterized by its unique structure that includes a dioxaborolane ring, contributing to its potential applications in organic synthesis and medicinal chemistry. The presence of the tetramethyl groups enhances its stability and solubility in organic solvents. It may exhibit interesting properties such as fluorescence or reactivity towards nucleophiles, making it useful in various chemical reactions, including cross-coupling reactions in the formation of carbon-carbon bonds. Additionally, the boron atom can play a significant role in coordination chemistry and may facilitate the development of new materials or pharmaceuticals. Overall, this compound's distinctive features make it a subject of interest in research and development within the fields of organic and medicinal chemistry.

Formula: C₁₃H₁₉BN₂O₃

InChI: InChI=1/C13H19BN2O3/c1-12(2)13(3,4)19-14(18-12)9-5-7-10(8-6-9)16-11(15)17/h5-8H,1-4H3,(H3,15,16,17)

SMILES: CC1(C)C(C)(C)OB(c2ccc(cc2)NC(=N)O)O1

1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea

CAS: 877134-77-5

Formula: C₁₃H₁₉BN₂O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 262.1126

Ref: IN-DA008DO9

4-(Carbamoylamino)benzeneboronic acid, pinacol ester

CAS: 877134-77-5

4-(Carbamoylamino)benzeneboronic acid, pinacol ester

Formula: C₁₃H₁₉BN₂O₃

Purity: 98%

Color and Shape: gray solid

Molecular weight: 262.11g/mol

Ref: 54-OR3259

1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea

CAS: 877134-77-5

Purity: 98%

Molecular weight: 262.1199951

Ref: 10-F694171