CAS 877149-08-1

4-Bromo-2-methoxy-6-methylbenzoic acid

Description:

4-Bromo-2-methoxy-6-methylbenzoic acid is an aromatic carboxylic acid characterized by its bromine, methoxy, and methyl substituents on a benzoic acid framework. The presence of the bromine atom at the 4-position, a methoxy group at the 2-position, and a methyl group at the 6-position contributes to its unique chemical properties and reactivity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the aromatic ring and substituents. It can participate in various chemical reactions, including electrophilic aromatic substitution and esterification, making it useful in organic synthesis. The carboxylic acid functional group imparts acidic properties, allowing it to engage in acid-base reactions. Additionally, the compound may exhibit biological activity, which can be explored in pharmaceutical applications. Its structural characteristics and functional groups make it a valuable compound in research and development within the fields of organic chemistry and medicinal chemistry.

Formula: C₉H₉BrO₃

InChI: InChI=1S/C9H9BrO3/c1-5-3-6(10)4-7(13-2)8(5)9(11)12/h3-4H,1-2H3,(H,11,12)

InChI key: InChIKey=RLDCUIJIUVPBBV-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(O)=O)C(C)=CC(Br)=C1

Synonyms:

• Benzoic acid, 4-bromo-2-methoxy-6-methyl-
• 4-Bromo-2-methoxy-6-methylbenzoic acid

4-Bromo-2-methoxy-6-methylbenzoic acid

CAS: 877149-08-1

Formula: C₉H₉BrO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 245.0700

Ref: IN-DA00H11I

4-Bromo-2-methoxy-6-methylbenzoic acid

CAS: 877149-08-1

4-Bromo-2-methoxy-6-methylbenzoic acid

Purity: 97%

Molecular weight: 245.07g/mol

Ref: 54-OR1035974

4-Bromo-2-methoxy-6-methylbenzoic acid

CAS: 877149-08-1

Formula: C₉H₉BrO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 245.072

Ref: 10-F329191