CAS 877149-13-8

4-Bromo-2-chloro-6-methylbenzamide

Description:

4-Bromo-2-chloro-6-methylbenzamide is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom at the para position, a chlorine atom at the ortho position, and a methyl group at the meta position relative to the amide functional group. The presence of these halogen substituents can influence the compound's reactivity and physical properties, such as solubility and boiling point. As an amide, it features a carbonyl group (C=O) directly attached to a nitrogen atom, which contributes to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. The compound may exhibit moderate to high polarity due to the electronegative halogens and the amide group, affecting its interactions in various chemical environments. Additionally, the presence of multiple substituents can lead to interesting electronic effects, making it a subject of interest in medicinal chemistry and materials science. Safety and handling precautions should be observed, as with many halogenated compounds, due to potential toxicity and environmental impact.

Formula: C₈H₇BrClNO

InChI: InChI=1S/C8H7BrClNO/c1-4-2-5(9)3-6(10)7(4)8(11)12/h2-3H,1H3,(H2,11,12)

InChI key: InChIKey=UBQOWAZMOIWUIJ-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=C(C)C=C(Br)C=C1Cl

Synonyms:

• 4-Bromo-2-chloro-6-methylbenzamide
• Benzamide, 4-bromo-2-chloro-6-methyl-
• 4-Bromo-2-chloro-6-methyl-benzamide