CymitQuimica logo

CAS 877149-81-0

:

[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridyl]methanol

Description:
The chemical substance known as [5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridyl]methanol, with the CAS number 877149-81-0, is a boron-containing compound that features a pyridine ring substituted with a methanol group and a dioxaborolane moiety. This compound is characterized by its unique structural features, which include a pyridine nitrogen that can participate in coordination chemistry and a boron atom that can form stable complexes with various ligands. The presence of the dioxaborolane group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-based reagents or catalysts. Additionally, the tetramethyl substituents enhance the stability and solubility of the compound in organic solvents. Its properties may include moderate polarity, making it suitable for various chemical reactions, including cross-coupling reactions. Overall, this compound exemplifies the versatility of boron chemistry in organic synthesis and its potential utility in pharmaceutical applications.
Formula:C12H18BNO3
InChI:InChI=1/C12H18BNO3/c1-11(2)12(3,4)17-13(16-11)10-5-9(8-15)6-14-7-10/h5-7,15H,8H2,1-4H3
InChI key:MMZYOXJIDQOQJT-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cc(cnc2)CO)O1
Found 5 products.