
CAS 877151-19-4
:6-Fluoro-2,3-dihydro-7-iodo-1H-isoindol-1-one
Description:
6-Fluoro-2,3-dihydro-7-iodo-1H-isoindol-1-one is a chemical compound characterized by its unique structural features, which include a fused isoindole ring system. The presence of a fluorine atom at the 6-position and an iodine atom at the 7-position contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound, and its molecular structure suggests it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. The dihydro form indicates that it has a saturated ring system, which can influence its stability and interactions with biological targets. Additionally, the presence of halogens (fluorine and iodine) often enhances lipophilicity and can affect the compound's ability to penetrate biological membranes. Overall, 6-Fluoro-2,3-dihydro-7-iodo-1H-isoindol-1-one is a compound of interest for further research, particularly in the fields of drug discovery and development.
Formula:C8H5FINO
InChI:InChI=1S/C8H5FINO/c9-5-2-1-4-3-11-8(12)6(4)7(5)10/h1-2H,3H2,(H,11,12)
InChI key:InChIKey=RDCWIRXWALFGDU-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC=C1F)CNC2=O
Synonyms:- 6-Fluoro-2,3-dihydro-7-iodo-1H-isoindol-1-one
- 1H-Isoindol-1-one, 6-fluoro-2,3-dihydro-7-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.