CAS 877161-74-5

2-Bromo-1,5-difluoro-3-nitrobenzene

Description:

2-Bromo-1,5-difluoro-3-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, two fluorine atoms, and a nitro group attached to a benzene ring. The bromine and fluorine substituents are located at the 2 and 1,5 positions, respectively, while the nitro group is positioned at the 3 position of the benzene ring. This compound exhibits a range of chemical properties typical of halogenated nitrobenzenes, including increased reactivity due to the presence of electronegative substituents. The fluorine atoms contribute to its lipophilicity and can influence its reactivity in nucleophilic substitution reactions. The nitro group is a strong electron-withdrawing group, which can enhance the electrophilic character of the aromatic ring, making it more susceptible to further substitution reactions. Additionally, the compound may exhibit distinct physical properties such as melting and boiling points, solubility in organic solvents, and potential applications in pharmaceuticals or agrochemicals due to its unique structural features. Safety and handling precautions should be observed, as with many halogenated compounds.

Formula: C₆H₂BrF₂NO₂

InChI: InChI=1S/C6H2BrF2NO2/c7-6-4(9)1-3(8)2-5(6)10(11)12/h1-2H

SMILES: c1c(cc(c(c1F)Br)N(=O)=O)F

Synonyms:

• 2-Bromo-3,5-Difluoro-1-Nitrobenzene
• 2-Bromo-3,5-difluoronitrobenzene

2-Bromo-1,5-difluoro-3-nitrobenzene

CAS: 877161-74-5

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 237.9864

Ref: IN-DA008DO7

2-Bromo-1,5-difluoro-3-nitrobenzene

CAS: 877161-74-5

2-Bromo-1,5-difluoro-3-nitrobenzene

Purity: 98%

Molecular weight: 237.99g/mol

Ref: 54-PC906985

2-Bromo-1,5-difluoro-3-nitrobenzene

CAS: 877161-74-5

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: Liquid

Molecular weight: 237.988

Ref: 10-F233851