CAS 877173-81-4

1,1-Dimethylethyl 3-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)-1-piperidinecarboxylate, with the CAS number 877173-81-4, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrazolo-pyrimidine moiety. This compound typically exhibits properties associated with its functional groups, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the chloropyrazolo group suggests possible interactions with biological targets, potentially influencing its pharmacological profile. Additionally, the dimethyl group contributes to steric hindrance, which can affect the compound's reactivity and binding affinity. As a carboxylate ester, it may also demonstrate solubility in organic solvents and stability under certain conditions. Overall, this compound's unique structural features may confer specific properties that are valuable in research and development, particularly in the fields of drug discovery and development.

Formula: C₁₆H₂₁ClN₄O₂

InChI: InChI=1S/C16H21ClN4O2/c1-16(2,3)23-15(22)20-8-4-5-11(10-20)12-9-13(17)21-14(19-12)6-7-18-21/h6-7,9,11H,4-5,8,10H2,1-3H3

InChI key: InChIKey=BGZBYRDJBDYNKD-UHFFFAOYSA-N

SMILES: ClC=1N2C(N=C(C1)C3CN(C(OC(C)(C)C)=O)CCC3)=CC=N2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-(7-chloropyrazolo[1,5-a]pyrimidin-5-yl)-1-piperidinecarboxylate