CymitQuimica logo

CAS 877264-43-2

:

5-Fluoro-2-iodobenzenemethanol

Description:
5-Fluoro-2-iodobenzenemethanol is an organic compound characterized by the presence of a benzene ring substituted with both a fluorine and an iodine atom, along with a hydroxymethyl group (-CH2OH). This compound features a unique combination of halogen substituents, which can influence its reactivity and properties. The fluorine atom typically imparts lipophilicity and can enhance the compound's biological activity, while the iodine atom may contribute to its potential as a precursor in various synthetic pathways. The hydroxymethyl group provides a site for further functionalization, making it a versatile intermediate in organic synthesis. Additionally, the presence of both halogens can affect the compound's electronic properties, potentially making it useful in medicinal chemistry and material science. Its molecular structure suggests that it may exhibit interesting interactions in biological systems, warranting further investigation into its pharmacological potential. As with many halogenated compounds, considerations regarding environmental impact and safety are essential during handling and application.
Formula:C7H6FIO
InChI:InChI=1S/C7H6FIO/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4H2
InChI key:InChIKey=SLFLIEHAFIVXNZ-UHFFFAOYSA-N
SMILES:C(O)C1=C(I)C=CC(F)=C1
Synonyms:
  • Benzenemethanol, 5-fluoro-2-iodo-
  • (5-Fluoro-2-iodophenyl)methanol
  • 5-Fluoro-2-iodobenzyl alcohol
  • 5-Fluoro-2-iodobenzenemethanol
Found 4 products.