
CAS 877264-49-8
:1-Benzo[b]thien-6-yl-2-bromoethanone
Description:
1-Benzo[b]thien-6-yl-2-bromoethanone is a chemical compound characterized by its unique structure, which includes a benzo[b]thienyl group and a bromoethanone moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential reactivity due to the presence of the bromine atom and the carbonyl group. The benzo[b]thienyl portion contributes to its aromatic stability and may influence its solubility and interaction with biological systems. The presence of the bromine atom can enhance electrophilic reactivity, making it a useful intermediate in organic synthesis. Additionally, compounds like this may exhibit interesting biological activities, which can be explored in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or materials science, depending on the specific functional groups and their arrangement. As with many organic compounds, the physical properties such as melting point, boiling point, and solubility would depend on the specific conditions and purity of the substance.
Formula:C10H7BrOS
InChI:InChI=1S/C10H7BrOS/c11-6-9(12)8-2-1-7-3-4-13-10(7)5-8/h1-5H,6H2
InChI key:InChIKey=DYAZWAYWJNTVEN-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C=1C=C2C(=CC1)C=CS2
Synonyms:- 1-Benzo[b]thien-6-yl-2-bromoethanone
- Ethanone, 1-benzo[b]thien-6-yl-2-bromo-
- 1-(1-Benzothiophen-6-yl)-2-bromoethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.